Sotirimod
Modify Date: 2025-09-18 07:59:46
Sotirimod structure
|
Common Name | Sotirimod | ||
|---|---|---|---|---|
| CAS Number | 227318-75-4 | Molecular Weight | 255.31800 | |
| Density | 1.33g/cm3 | Boiling Point | 493.9ºC at 760mmHg | |
| Molecular Formula | C14H17N5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 252.5ºC | |
Use of SotirimodSotirimod is an immunostimulant, and can potentially treat for actinic keratosis. |
| Name | 2-methyl-1-(2-methylpropyl)imidazo[4,5-c][1,5]naphthyridin-4-amine |
|---|---|
| Synonym | More Synonyms |
| Description | Sotirimod is an immunostimulant, and can potentially treat for actinic keratosis. |
|---|---|
| Related Catalog |
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 493.9ºC at 760mmHg |
| Molecular Formula | C14H17N5 |
| Molecular Weight | 255.31800 |
| Flash Point | 252.5ºC |
| Exact Mass | 255.14800 |
| PSA | 70.35000 |
| LogP | 2.45620 |
| Vapour Pressure | 6.73E-10mmHg at 25°C |
| Index of Refraction | 1.698 |
| InChIKey | ZXBCLVSLRUWISJ-UHFFFAOYSA-N |
| SMILES | Cc1nc2c(N)nc3cccnc3c2n1CC(C)C |
| Storage condition | 2-8℃ |
| Sotirimod (USAN) |
| Sotirimod |
| R-850 |
| UNII-X04FQM7J4M |