4-methoxy-N,N-bis(oxiran-2-ylmethyl)aniline structure
|
Common Name | 4-methoxy-N,N-bis(oxiran-2-ylmethyl)aniline | ||
|---|---|---|---|---|
| CAS Number | 22713-53-7 | Molecular Weight | 235.27900 | |
| Density | 1.225g/cm3 | Boiling Point | 393.2ºC at 760mmHg | |
| Molecular Formula | C13H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 123.8ºC | |
| Name | 4-methoxy-N,N-bis(oxiran-2-ylmethyl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.225g/cm3 |
|---|---|
| Boiling Point | 393.2ºC at 760mmHg |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.27900 |
| Flash Point | 123.8ºC |
| Exact Mass | 235.12100 |
| PSA | 37.53000 |
| LogP | 1.29920 |
| Vapour Pressure | 2.17E-06mmHg at 25°C |
| Index of Refraction | 1.591 |
| InChIKey | GZSNKIGDHQFEGU-UHFFFAOYSA-N |
| SMILES | COc1ccc(N(CC2CO2)CC2CO2)cc1 |
|
~%
4-methoxy-N,N-b... CAS#:22713-53-7 |
| Literature: Davis et al. Journal of the Chemical Society, 1950 , p. 1331,1332 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| N,N-bis-oxiranylmethyl-p-anisidine |
| 4-methoxy-N,N-bis-oxiranylmethyl-aniline |
| N,N-Bis-oxiranylmethyl-p-anisidin |