3,8,10-trimethyl-2,3,5,8,10-pentazabicyclo[4.4.0]deca-1,5-diene-4,7,9-trione structure
|
Common Name | 3,8,10-trimethyl-2,3,5,8,10-pentazabicyclo[4.4.0]deca-1,5-diene-4,7,9-trione | ||
|---|---|---|---|---|
| CAS Number | 22712-32-9 | Molecular Weight | 223.18900 | |
| Density | 1.64g/cm3 | Boiling Point | 298.6ºC at 760mmHg | |
| Molecular Formula | C8H9N5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 134.4ºC | |
| Name | 2,6,8-trimethylpyrimido[5,4-e][1,2,4]triazine-3,5,7-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.64g/cm3 |
|---|---|
| Boiling Point | 298.6ºC at 760mmHg |
| Molecular Formula | C8H9N5O3 |
| Molecular Weight | 223.18900 |
| Flash Point | 134.4ºC |
| Exact Mass | 223.07100 |
| PSA | 91.78000 |
| Vapour Pressure | 0.00125mmHg at 25°C |
| Index of Refraction | 1.733 |
| InChIKey | NLCDJWLDGSBUOQ-UHFFFAOYSA-N |
| SMILES | Cn1nc2c(nc1=O)c(=O)n(C)c(=O)n2C |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Methylfervenulon |
| MSD-92 |
| 2-Methyl-fervenulone |
| 2-Methyl-fervenulin |