4-Heptanone,1,1,1-trichloro-2-hydroxy-6-methyl- structure
|
Common Name | 4-Heptanone,1,1,1-trichloro-2-hydroxy-6-methyl- | ||
|---|---|---|---|---|
| CAS Number | 22703-72-6 | Molecular Weight | 247.54700 | |
| Density | 1.301g/cm3 | Boiling Point | 312.2ºC at 760mmHg | |
| Molecular Formula | C8H13Cl3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 142.6ºC | |
| Name | 1,1,1-trichloro-2-hydroxy-6-methylheptan-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.301g/cm3 |
|---|---|
| Boiling Point | 312.2ºC at 760mmHg |
| Molecular Formula | C8H13Cl3O2 |
| Molecular Weight | 247.54700 |
| Flash Point | 142.6ºC |
| Exact Mass | 245.99800 |
| PSA | 37.30000 |
| LogP | 2.72280 |
| Vapour Pressure | 4.71E-05mmHg at 25°C |
| Index of Refraction | 1.491 |
| InChIKey | LXHWHFYGBOTFKX-UHFFFAOYSA-N |
| SMILES | CC(C)CC(=O)CC(O)C(Cl)(Cl)Cl |
|
~%
4-Heptanone,1,1... CAS#:22703-72-6 |
| Literature: Kiehlmann,E.; Loo,P.-W. Canadian Journal of Chemistry, 1971 , vol. 49, p. 1588 - 1597 |
|
~%
4-Heptanone,1,1... CAS#:22703-72-6 |
| Literature: Tsuboi,S. et al. Bulletin of the Chemical Society of Japan, 1974 , vol. 47, p. 1673 - 1677 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1,1,1-Trichlor-2-hydroxy-6-methyl-4-heptanon |
| 1,1,1-Trichlor-6-methylheptan-2-ol-4-on |
| 1,1,1-Trichlor-6-methyl-4-oxo-heptan-2-ol |
| 1,1,1-Trichlor-2-hydroxy-6-methyl-heptan-4-on |
| 1,1,1-trichloro-2-hydroxy-6-methyl-4-heptanone |
| 1,1,1-trichloro-2-hydroxy-6-methyl-heptan-4-one |