2-Methyl-2-(1-methylethyl)propane-1,3-diol dicarbamate
Modify Date: 2025-09-22 20:03:01
2-Methyl-2-(1-methylethyl)propane-1,3-diol dicarbamate structure
|
Common Name | 2-Methyl-2-(1-methylethyl)propane-1,3-diol dicarbamate | ||
|---|---|---|---|---|
| CAS Number | 2270-89-5 | Molecular Weight | 218.25000 | |
| Density | 1.137g/cm3 | Boiling Point | 426.4ºC at 760 mmHg | |
| Molecular Formula | C9H18N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.2ºC | |
| Name | [2-(carbamoyloxymethyl)-2,3-dimethylbutyl] carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.137g/cm3 |
|---|---|
| Boiling Point | 426.4ºC at 760 mmHg |
| Molecular Formula | C9H18N2O4 |
| Molecular Weight | 218.25000 |
| Flash Point | 223.2ºC |
| Exact Mass | 218.12700 |
| PSA | 106.62000 |
| LogP | 1.86690 |
| Vapour Pressure | 1.77E-07mmHg at 25°C |
| Index of Refraction | 1.477 |
| InChIKey | CYBHZZZXLCUSQA-UHFFFAOYSA-N |
| SMILES | CC(C)C(C)(COC(N)=O)COC(N)=O |
| HS Code | 2924199090 |
|---|
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-isopropyl-4-methyl-2,6-dioxa-heptanedioic acid diamide |
| 4-Isopropyl-4-methyl-2,6-dioxa-heptandisaeure-diamid |
| 2-Isopropyl-2-methyl-1,3-propanediol dicarbamate |
| 1,3-Propanediol,2-isopropyl-2-methyl-,dicarbamate |
| 1-Carbamoyloxy-2-carbamoyloxymethyl-2,3-dimethyl-butan |
| 1,3-Bis-carbamoyloxy-2-isopropyl-2-methyl-propan |