7-[2-(benzylamino)ethyl]-3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione structure
|
Common Name | 7-[2-(benzylamino)ethyl]-3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 22680-61-1 | Molecular Weight | 313.35400 | |
| Density | 1.3g/cm3 | Boiling Point | 546.5ºC at 760mmHg | |
| Molecular Formula | C16H19N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 284.3ºC | |
| Name | 7-[2-(benzylamino)ethyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 546.5ºC at 760mmHg |
| Molecular Formula | C16H19N5O2 |
| Molecular Weight | 313.35400 |
| Flash Point | 284.3ºC |
| Exact Mass | 313.15400 |
| PSA | 73.85000 |
| LogP | 0.61440 |
| Vapour Pressure | 5.35E-12mmHg at 25°C |
| Index of Refraction | 1.656 |
| InChIKey | YYJAAIPVBNSAGS-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)c2c(ncn2CCNCc2ccccc2)n(C)c1=O |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| einecs 245-155-7 |