1-Propanone, 2,3,3,3-tetrafluoro-1-phenyl- (9CI) structure
|
Common Name | 1-Propanone, 2,3,3,3-tetrafluoro-1-phenyl- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 2267-65-4 | Molecular Weight | 206.13700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H6F4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,3,3,3-tetrafluoro-1-phenylpropan-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H6F4O |
|---|---|
| Molecular Weight | 206.13700 |
| Exact Mass | 206.03500 |
| PSA | 17.07000 |
| LogP | 2.76970 |
| InChIKey | MGVPMFSYZYUVSV-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)C(F)C(F)(F)F |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| phenyl 1,2,2,2,-tetrafluoroethyl ketone |
| 1,1,1,2-Tetrafluoropropiophenon |
| 2,3,3,3-tetrafluoropropiophenone |
| 1-PROPANONE,2,3,3,3-TETRAFLUORO-1-PHENYL |