ethyl (3,4-dimethoxyphenyl)methylcarbamothioylsulfanylformate
Modify Date: 2025-08-20 20:39:49
ethyl (3,4-dimethoxyphenyl)methylcarbamothioylsulfanylformate structure
|
Common Name | ethyl (3,4-dimethoxyphenyl)methylcarbamothioylsulfanylformate | ||
|---|---|---|---|---|
| CAS Number | 22623-49-0 | Molecular Weight | 315.40800 | |
| Density | 1.256g/cm3 | Boiling Point | 430.9ºC at 760mmHg | |
| Molecular Formula | C13H17NO4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.4ºC | |
| Name | ethyl (3,4-dimethoxyphenyl)methylcarbamothioylsulfanylformate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.256g/cm3 |
|---|---|
| Boiling Point | 430.9ºC at 760mmHg |
| Molecular Formula | C13H17NO4S2 |
| Molecular Weight | 315.40800 |
| Flash Point | 214.4ºC |
| Exact Mass | 315.06000 |
| PSA | 121.22000 |
| LogP | 3.37930 |
| Vapour Pressure | 1.25E-07mmHg at 25°C |
| Index of Refraction | 1.581 |
| InChIKey | SFZGAFLNQLJACJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)SC(=S)NCc1ccc(OC)c(OC)c1 |
| Carbonic acid,thio-,anhydrosulfide with dithioveratrylcarbamic acid,ethyl ester |
| Thiocarbonic acid anhydrosulfide with dithioveratrylcarbamic acid ethyl ester |