Benzamide,N,N-bis(2-fluoroethyl)-3,4,5-trimethoxy- structure
|
Common Name | Benzamide,N,N-bis(2-fluoroethyl)-3,4,5-trimethoxy- | ||
|---|---|---|---|---|
| CAS Number | 2262-24-0 | Molecular Weight | 303.30200 | |
| Density | 1.163g/cm3 | Boiling Point | 449.6ºC at 760mmHg | |
| Molecular Formula | C14H19F2NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.7ºC | |
| Name | N,N-bis(2-fluoroethyl)-3,4,5-trimethoxybenzamide |
|---|
| Density | 1.163g/cm3 |
|---|---|
| Boiling Point | 449.6ºC at 760mmHg |
| Molecular Formula | C14H19F2NO4 |
| Molecular Weight | 303.30200 |
| Flash Point | 225.7ºC |
| Exact Mass | 303.12800 |
| PSA | 48.00000 |
| LogP | 2.09360 |
| Vapour Pressure | 2.82E-08mmHg at 25°C |
| Index of Refraction | 1.481 |
| InChIKey | OQBASORGUWVWGZ-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)N(CCF)CCF)cc(OC)c1OC |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |