Tioclomarol structure
|
Common Name | Tioclomarol | ||
|---|---|---|---|---|
| CAS Number | 22619-35-8 | Molecular Weight | 447.33 | |
| Density | 1.519g/cm3 | Boiling Point | 618.9ºC at 760mmHg | |
| Molecular Formula | C22H16Cl2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 328.1ºC | |
Use of TioclomarolTioclomarol, a coumarin anticoagulant, is a vitamin K antagonist[1]. |
| Name | 3-[3-(4-chlorophenyl)-1-(5-chlorothiophen-2-yl)-3-hydroxypropyl]-4-hydroxychromen-2-one |
|---|---|
| Synonym | More Synonyms |
| Description | Tioclomarol, a coumarin anticoagulant, is a vitamin K antagonist[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.519g/cm3 |
|---|---|
| Boiling Point | 618.9ºC at 760mmHg |
| Molecular Formula | C22H16Cl2O4S |
| Molecular Weight | 447.33 |
| Flash Point | 328.1ºC |
| Exact Mass | 446.01500 |
| PSA | 98.91000 |
| LogP | 6.12250 |
| Vapour Pressure | 3.55E-16mmHg at 25°C |
| Index of Refraction | 1.701 |
| InChIKey | WRGOVNKNTPWHLZ-UHFFFAOYSA-N |
| SMILES | O=c1oc2ccccc2c(O)c1C(CC(O)c1ccc(Cl)cc1)c1ccc(Cl)s1 |
| 3-[3-(4-chlorophenyl)-1-(5-chlorothiophen-2-yl)-3-hydroxypropyl]-2-hydroxy-4h-chromen-4-one |
| tioclomarol |
| Tioclomarolum [INN-Latin] |
| Tioclomarolum |
| UNII-E5B7C16LFK |
| Apegmone |
| Tioclomarol (INN) |