3-(dimethylamino)-2-methyl-1,1-diphenylpropan-1-ol structure
|
Common Name | 3-(dimethylamino)-2-methyl-1,1-diphenylpropan-1-ol | ||
|---|---|---|---|---|
| CAS Number | 2260-37-9 | Molecular Weight | 269.38100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H23NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(dimethylamino)-2-methyl-1,1-diphenylpropan-1-ol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H23NO |
|---|---|
| Molecular Weight | 269.38100 |
| Exact Mass | 269.17800 |
| PSA | 23.47000 |
| LogP | 3.12020 |
| InChIKey | IFCVOBDIZQICIA-UHFFFAOYSA-N |
| SMILES | CC(CN(C)C)C(O)(c1ccccc1)c1ccccc1 |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-dimethylamino-2-methyl-1,1-diphenyl-propan-1-ol |
| 1,1-Diphenyl-2-methyl-3-dimethylaminopropanol-1 |
| 1-Propanol,3-dimethylamino-1,1-diphenyl-2-methyl |
| 3-Dimethylamino-2-methyl-1,1-diphenyl-1-propanol |
| 2-Methyl-3-dimethylamino-1,1-diphenyl-propan-1-ol |