2,2-dichloro-N,N-dimethyl-3-oxobutyramide structure
|
Common Name | 2,2-dichloro-N,N-dimethyl-3-oxobutyramide | ||
|---|---|---|---|---|
| CAS Number | 22543-26-6 | Molecular Weight | 198.04700 | |
| Density | 1.303g/cm3 | Boiling Point | 221.4ºC at 760mmHg | |
| Molecular Formula | C6H9Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 87.7ºC | |
| Name | 2,2-dichloro-N,N-dimethyl-3-oxobutanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.303g/cm3 |
|---|---|
| Boiling Point | 221.4ºC at 760mmHg |
| Molecular Formula | C6H9Cl2NO2 |
| Molecular Weight | 198.04700 |
| Flash Point | 87.7ºC |
| Exact Mass | 197.00100 |
| PSA | 37.38000 |
| LogP | 0.83750 |
| Vapour Pressure | 0.107mmHg at 25°C |
| Index of Refraction | 1.481 |
| InChIKey | VZYZILNMQDUERW-UHFFFAOYSA-N |
| SMILES | CC(=O)C(Cl)(Cl)C(=O)N(C)C |
| HS Code | 2924199090 |
|---|
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2,2-dichloro-acetoacetic acid dimethylamide |
| 2,2-Dichlor-N,N-dimethyl-acetoacetamid |
| EINECS 245-068-4 |
| SD 6166 |
| 2,2-Dichlor-acetessigsaeure-dimethylamid |
| 2,2-dichloro-N,N-dimethyl-3-oxobutyramide |