O,O-dioctyl hydrogen dithiophosphate structure
|
Common Name | O,O-dioctyl hydrogen dithiophosphate | ||
|---|---|---|---|---|
| CAS Number | 2253-57-8 | Molecular Weight | 502.76900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C32H54O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [(3S,5R,7S,10S,13R,14R,17R)-7-hydroperoxy-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C32H54O4 |
|---|---|
| Molecular Weight | 502.76900 |
| Exact Mass | 502.40200 |
| PSA | 55.76000 |
| LogP | 8.59790 |
| Vapour Pressure | 4.9E-07mmHg at 25°C |
| InChIKey | ZUNYMXPJGBXUCI-UHFFFAOYSA-N |
| SMILES | CCCCCCCCOP(=S)(S)OCCCCCCCC |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| hydroperoxide,acetate |