Silanamine, 1,1,1-trimethyl-N-(pentafluorophenyl)-
Modify Date: 2025-09-17 19:26:03
Silanamine, 1,1,1-trimethyl-N-(pentafluorophenyl)- structure
|
Common Name | Silanamine, 1,1,1-trimethyl-N-(pentafluorophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 22529-97-1 | Molecular Weight | 255.26000 | |
| Density | 1.284g/cm3 | Boiling Point | 174.2ºC at 760mmHg | |
| Molecular Formula | C9H10F5NSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 59.2ºC | |
| Name | 2,3,4,5,6-pentafluoro-N-trimethylsilylaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.284g/cm3 |
|---|---|
| Boiling Point | 174.2ºC at 760mmHg |
| Molecular Formula | C9H10F5NSi |
| Molecular Weight | 255.26000 |
| Flash Point | 59.2ºC |
| Exact Mass | 255.05000 |
| PSA | 12.03000 |
| LogP | 3.70190 |
| Vapour Pressure | 1.22mmHg at 25°C |
| Index of Refraction | 1.454 |
| InChIKey | KWEFNENVOXDWHP-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)Nc1c(F)c(F)c(F)c(F)c1F |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Trimethyl-N-pentafluorphenyl-silylamin |
| Pentafluorphenylamino-trimethyl-silan |