Acetamide,2,2,2-trifluoro-N-(8-fluoro-7-nitro-9H-fluoren-2-yl)-
Modify Date: 2025-09-18 12:02:36
Acetamide,2,2,2-trifluoro-N-(8-fluoro-7-nitro-9H-fluoren-2-yl)- structure
|
Common Name | Acetamide,2,2,2-trifluoro-N-(8-fluoro-7-nitro-9H-fluoren-2-yl)- | ||
|---|---|---|---|---|
| CAS Number | 2251-20-9 | Molecular Weight | 340.22900 | |
| Density | 1.59g/cm3 | Boiling Point | 490.7ºC at 760mmHg | |
| Molecular Formula | C15H8F4N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 250.6ºC | |
| Name | 2,2,2-trifluoro-N-(8-fluoro-7-nitro-9H-fluoren-2-yl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.59g/cm3 |
|---|---|
| Boiling Point | 490.7ºC at 760mmHg |
| Molecular Formula | C15H8F4N2O3 |
| Molecular Weight | 340.22900 |
| Flash Point | 250.6ºC |
| Exact Mass | 340.04700 |
| PSA | 74.92000 |
| LogP | 4.40210 |
| Vapour Pressure | 8.94E-10mmHg at 25°C |
| Index of Refraction | 1.619 |
| InChIKey | HMEWPRQFVAQGFR-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc2c(c1)Cc1c-2ccc([N+](=O)[O-])c1F)C(F)(F)F |
|
~%
Acetamide,2,2,2... CAS#:2251-20-9 |
| Literature: Fletcher,T.L. et al. Journal of Organic Chemistry, 1960 , vol. 25, p. 996 - 1000 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 8-Fluor-7-nitro-2-trifluoracetamino-fluoren |