Itaconic acid dioctyl ester structure
|
Common Name | Itaconic acid dioctyl ester | ||
|---|---|---|---|---|
| CAS Number | 22501-68-4 | Molecular Weight | 354.52400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H38O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | dioctyl 2-methylidenebutanedioate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H38O4 |
|---|---|
| Molecular Weight | 354.52400 |
| Exact Mass | 354.27700 |
| PSA | 52.60000 |
| LogP | 5.74010 |
| InChIKey | NQPOXJIXYCVBDO-UHFFFAOYSA-N |
| SMILES | C=C(CC(=O)OCCCCCCCC)C(=O)OCCCCCCCC |
| HS Code | 2917190090 |
|---|
|
~%
Itaconic acid d... CAS#:22501-68-4 |
| Literature: Kumar, Gulshan; Aggarwal, Saroj; Choudhary, Veena Indian Journal of Chemistry - Section A Inorganic, Physical, Theoretical and Analytical Chemistry, 2003 , vol. 42, # 10 p. 2523 - 2526 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| di-n-octyl itaconate |
| methylene-succinic acid dioctyl ester |
| Butanedioic acid,methylene-,dioctyl ester |
| Methylen-bernsteinsaeure-dioctylester |