(E)-but-2-enedioic acid,N,N-dimethyl-2-[phenyl-[4-(trifluoromethyl)phenyl]methoxy]propan-1-amine
Modify Date: 2025-11-30 16:54:18
![(E)-but-2-enedioic acid,N,N-dimethyl-2-[phenyl-[4-(trifluoromethyl)phenyl]methoxy]propan-1-amine Structure](https://image.chemsrc.com/caspic/388/2250-12-6.png)
(E)-but-2-enedioic acid,N,N-dimethyl-2-[phenyl-[4-(trifluoromethyl)phenyl]methoxy]propan-1-amine structure
|
Common Name | (E)-but-2-enedioic acid,N,N-dimethyl-2-[phenyl-[4-(trifluoromethyl)phenyl]methoxy]propan-1-amine | ||
|---|---|---|---|---|
| CAS Number | 2250-12-6 | Molecular Weight | 453.45100 | |
| Density | N/A | Boiling Point | 370ºC at 760 mmHg | |
| Molecular Formula | C23H26F3NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.6ºC | |
| Name | (E)-but-2-enedioic acid,N,N-dimethyl-2-[phenyl-[4-(trifluoromethyl)phenyl]methoxy]propan-1-amine |
|---|
| Boiling Point | 370ºC at 760 mmHg |
|---|---|
| Molecular Formula | C23H26F3NO5 |
| Molecular Weight | 453.45100 |
| Flash Point | 177.6ºC |
| Exact Mass | 453.17600 |
| PSA | 87.07000 |
| LogP | 4.47330 |
| Vapour Pressure | 1.14E-05mmHg at 25°C |
| InChIKey | TUBZEXFUJAKSIP-WLHGVMLRSA-N |
| SMILES | CC(CN(C)C)OC(c1ccccc1)c1ccc(C(F)(F)F)cc1.O=C(O)C=CC(=O)O |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |