[3-(trifluoromethyl)phenyl] N-butylcarbamate
Modify Date: 2025-09-09 20:16:37
![[3-(trifluoromethyl)phenyl] N-butylcarbamate Structure](https://www.chemsrc.com/extcaspic/382/2249-29-8.png)
[3-(trifluoromethyl)phenyl] N-butylcarbamate structure
|
Common Name | [3-(trifluoromethyl)phenyl] N-butylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 2249-29-8 | Molecular Weight | 261.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14F3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [3-(trifluoromethyl)phenyl] N-butylcarbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H14F3NO2 |
|---|---|
| Molecular Weight | 261.24 |
| InChIKey | RDLRIYQLKIJOKX-UHFFFAOYSA-N |
| SMILES | CCCCNC(=O)Oc1cccc(C(F)(F)F)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of [3-(trifluoromethyl)phenyl] N-butylcarbamate? |
| A: CAS number of [3-(trifluoromethyl)phenyl] N-butylcarbamate is 2249-29-8. |
| Q: What is the InChIKey of [3-(trifluoromethyl)phenyl] N-butylcarbamate? |
| A: InChIKey of [3-(trifluoromethyl)phenyl] N-butylcarbamate is RDLRIYQLKIJOKX-UHFFFAOYSA-N. |
| Q: What is the English name of [3-(trifluoromethyl)phenyl] N-butylcarbamate? |
| A: The English name of [3-(trifluoromethyl)phenyl] N-butylcarbamate is [3-(trifluoromethyl)phenyl] N-butylcarbamate. |
| Q: What is the SMILES notation of [3-(trifluoromethyl)phenyl] N-butylcarbamate? |
| A: SMILES notation of [3-(trifluoromethyl)phenyl] N-butylcarbamate is CCCCNC(=O)Oc1cccc(C(F)(F)F)c1. |
| Q: What is the molecular weight of [3-(trifluoromethyl)phenyl] N-butylcarbamate? |
| A: Molecular weight of [3-(trifluoromethyl)phenyl] N-butylcarbamate is 261.24. |
| Q: What is the Chinese name of 2249-29-8? |
| A: Chinese name of 2249-29-8 is 2249-29-8. |
| Q: What is the molecular formula of [3-(trifluoromethyl)phenyl] N-butylcarbamate? |
| A: Molecular formula of [3-(trifluoromethyl)phenyl] N-butylcarbamate is C12H14F3NO2. |