dimethyl 4-hydroxy-5-methylbenzene-1,2-dicarboxylate
Modify Date: 2025-08-25 23:11:38
dimethyl 4-hydroxy-5-methylbenzene-1,2-dicarboxylate structure
|
Common Name | dimethyl 4-hydroxy-5-methylbenzene-1,2-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 22481-13-6 | Molecular Weight | 224.21000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | dimethyl 4-hydroxy-5-methylbenzene-1,2-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H12O5 |
|---|---|
| Molecular Weight | 224.21000 |
| Exact Mass | 224.06800 |
| PSA | 72.83000 |
| LogP | 1.27380 |
| InChIKey | CLVLHEUGSSSULY-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(C)c(O)cc1C(=O)OC |
| HS Code | 2918199090 |
|---|
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| dimethyl 4-hydroxy-5-methylphthalate |