anhalidine structure
|
Common Name | anhalidine | ||
|---|---|---|---|---|
| CAS Number | 2245-94-5 | Molecular Weight | 223.26800 | |
| Density | 1.152g/cm3 | Boiling Point | 346ºC at 760mmHg | |
| Molecular Formula | C12H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163ºC | |
| Name | 6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-8-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.152g/cm3 |
|---|---|
| Boiling Point | 346ºC at 760mmHg |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.26800 |
| Flash Point | 163ºC |
| Exact Mass | 223.12100 |
| PSA | 41.93000 |
| LogP | 1.33520 |
| Vapour Pressure | 2.97E-05mmHg at 25°C |
| Index of Refraction | 1.552 |
| InChIKey | DTXOXOHMRGAFDX-UHFFFAOYSA-N |
| SMILES | COc1cc2c(c(O)c1OC)CN(C)CC2 |
| HS Code | 2933499090 |
|---|
|
~%
anhalidine CAS#:2245-94-5 |
| Literature: Inubushi; Fujitani Yakugaku Zasshi, 1958 , vol. 78, p. 486,489 Chem.Abstr., 1958 , p. 17273 |
|
~%
anhalidine CAS#:2245-94-5 |
| Literature: Spaeth; Becke Chemische Berichte, vol. 68, p. 944 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 8-Isoquinolinol,1,2,3,4-tetrahydro-6,7-dimethoxy-2-methyl |
| 8-Hydroxy-2-methyl-6,7-dimethoxy-1,2,3,4-tetrahydro-isochinolin |
| 6,7-Dimethoxy-2-methyl-1,2,3,4-tetrahydro-isochinolin-8-ol |
| 6,7-dimethoxy-2-methyl-1,2,3,4-tetrahydro-isoquinolin-8-ol |
| Anhalidine |