Ethyl 2-(3-bromophenyl)-5-hydroxybenzofuran-3-carboxylate
Modify Date: 2025-09-05 21:06:31
Ethyl 2-(3-bromophenyl)-5-hydroxybenzofuran-3-carboxylate structure
|
Common Name | Ethyl 2-(3-bromophenyl)-5-hydroxybenzofuran-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2244978-46-7 | Molecular Weight | 361.2 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H13BrO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Ethyl 2-(3-bromophenyl)-5-hydroxybenzofuran-3-carboxylate |
|---|
| Molecular Formula | C17H13BrO4 |
|---|---|
| Molecular Weight | 361.2 |
| InChIKey | AJUFJIRRYLVRCU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c(-c2cccc(Br)c2)oc2ccc(O)cc12 |
|
Name: Inhibition of recombinant human 5-LO expressed in Escherichia coli BL21 using arachid...
Source: ChEMBL
Target: Polyunsaturated fatty acid 5-lipoxygenase
External Id: CHEMBL4273118
|
|
Name: Inhibition of 5-LO in human peripheral blood neutrophils using arachidonic acid as su...
Source: ChEMBL
Target: Polyunsaturated fatty acid 5-lipoxygenase
External Id: CHEMBL4273117
|
Total 2, Current Page 1 of 1
1