2,2,3,4,4-PENTACHLORO-1,2,3,4-TETRAHYDRONAPHTHALEN-1-ONE structure
|
Common Name | 2,2,3,4,4-PENTACHLORO-1,2,3,4-TETRAHYDRONAPHTHALEN-1-ONE | ||
|---|---|---|---|---|
| CAS Number | 2243-28-9 | Molecular Weight | 318.41100 | |
| Density | 1.65g/cm3 | Boiling Point | 385.1ºC at 760mmHg | |
| Molecular Formula | C10H5Cl5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.8ºC | |
| Name | 2,2,3,4,4-pentachloro-3H-naphthalen-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.65g/cm3 |
|---|---|
| Boiling Point | 385.1ºC at 760mmHg |
| Molecular Formula | C10H5Cl5O |
| Molecular Weight | 318.41100 |
| Flash Point | 162.8ºC |
| Exact Mass | 315.87800 |
| PSA | 17.07000 |
| LogP | 4.29460 |
| Vapour Pressure | 3.91E-06mmHg at 25°C |
| Index of Refraction | 1.617 |
| InChIKey | AVRLSFVAMORTAF-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(Cl)(Cl)C(Cl)C1(Cl)Cl |
| HS Code | 2914700090 |
|---|
|
~69%
2,2,3,4,4-PENTA... CAS#:2243-28-9 |
| Literature: Brummer; Weiss Berichte der Bunsengesellschaft/Physical Chemistry Chemical Physics, 1987 , vol. 91, # 9 p. 873 - 879 |
|
~%
2,2,3,4,4-PENTA... CAS#:2243-28-9 |
| Literature: Rege; Airan; Shah Journal of the Indian Chemical Society, 1948 , vol. 25, p. 43,44 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2,2,3,4,4-Pentachlor-3,4-dihydro-2H-naphthalin-1-on |
| 2.2.3.4.4-Pentachlor-1-oxo-naphthalintetrahydrid |
| 2,2,3,4,4-pentachloro-1-oxo-1,2,3,4-tetrahydronaphthaline |
| 2,2,3,4,4-Pentachlor-1-tetralon |
| 2,2,3,4,4-pentachloro-2,3,4-trihydronaphthalen-1-one |
| 2,2,3,4,4-Pentachloro-1-tetralone |
| 2,2,3,4,4-Pentachlor-1-oxo-1,2,3,4-tetrahydro-naphthalin |
| 2,2,3,4,4-pentachloro-3,4-dihydro-2H-naphthalen-1-one |