Naphthalene-2,3-diol diacetate structure
|
Common Name | Naphthalene-2,3-diol diacetate | ||
|---|---|---|---|---|
| CAS Number | 22426-46-6 | Molecular Weight | 244.24300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | naphthalene-2,3-diyl diacetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H12O4 |
|---|---|
| Molecular Weight | 244.24300 |
| Exact Mass | 244.07400 |
| PSA | 52.60000 |
| LogP | 2.69040 |
| InChIKey | XHLDTNXMAXJFEH-UHFFFAOYSA-N |
| SMILES | CC(=O)O.CC(=O)O.Oc1cc2ccccc2cc1O |
| HS Code | 2915390090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2915390090 |
|---|---|
| Summary | 2915390090. esters of acetic acid. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:5.5%. General tariff:30.0% |
| 2,3-diacetoxy-naphthalene |
| 2,3-Acetoxynaphthalene |
| 2,3-Diacetoxy-naphthalin |
| 2,3-Dihydroxy-naphthalin-diacetat |