[(2,6-dibromo-4-methylphenoxy)methyl]oxirane structure
|
Common Name | [(2,6-dibromo-4-methylphenoxy)methyl]oxirane | ||
|---|---|---|---|---|
| CAS Number | 22421-59-6 | Molecular Weight | 321.99300 | |
| Density | 1.765g/cm3 | Boiling Point | 354.4ºC at 760mmHg | |
| Molecular Formula | C10H10Br2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 144.6ºC | |
| Name | 2-[(2,6-dibromo-4-methylphenoxy)methyl]oxirane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.765g/cm3 |
|---|---|
| Boiling Point | 354.4ºC at 760mmHg |
| Molecular Formula | C10H10Br2O2 |
| Molecular Weight | 321.99300 |
| Flash Point | 144.6ºC |
| Exact Mass | 319.90500 |
| PSA | 21.76000 |
| LogP | 3.29760 |
| Vapour Pressure | 6.88E-05mmHg at 25°C |
| Index of Refraction | 1.595 |
| InChIKey | XWEPFVUYXGEZOY-UHFFFAOYSA-N |
| SMILES | Cc1cc(Br)c(OCC2CO2)c(Br)c1 |
| HS Code | 2910900090 |
|---|
| HS Code | 2910900090 |
|---|---|
| Summary | 2910900090. epoxides, epoxyalcohols, epoxyphenols and epoxyethers, with a three-membered ring, and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| Dibromo-4-methylphenyl glycidyl ether,2,6 |
| 4-methyl-2,6-dibromophenyl glycidyl ether |
| EINECS 244-986-2 |
| 2,6-Dibromo-4-methylphenyl glycidyl ether |