Incensole
Modify Date: 2025-08-25 19:33:11
Incensole structure
|
Common Name | Incensole | ||
|---|---|---|---|---|
| CAS Number | 22419-74-5 | Molecular Weight | 306.48300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H34O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of IncensoleIncensole, a 14-membered diterpenoid, is isolated from both essential oils and resins of frankincense. Incensole has shown anti-inflammatory and anti-depression activities due to their ability to activate ion channels in the brain to alleviate anxiety or depression[1]. |
| Name | incensole |
|---|---|
| Synonym | More Synonyms |
| Description | Incensole, a 14-membered diterpenoid, is isolated from both essential oils and resins of frankincense. Incensole has shown anti-inflammatory and anti-depression activities due to their ability to activate ion channels in the brain to alleviate anxiety or depression[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C20H34O2 |
|---|---|
| Molecular Weight | 306.48300 |
| Exact Mass | 306.25600 |
| PSA | 29.46000 |
| LogP | 5.16790 |
| InChIKey | SSBZLMMXFQMHDP-WTOPSPMMSA-N |
| SMILES | CC1=CCC2(C(C)C)CCC(C)(O2)C(O)CCC(C)=CCC1 |
| dl-Incensol |