(2-Phenoxyethyl)(triphenyl)phosphonium bromide structure
|
Common Name | (2-Phenoxyethyl)(triphenyl)phosphonium bromide | ||
|---|---|---|---|---|
| CAS Number | 22409-83-2 | Molecular Weight | 463.346 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H24BrOP | Melting Point | 103ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-phenoxyethyl(triphenyl)phosphanium,bromide |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 103ºC |
|---|---|
| Molecular Formula | C26H24BrOP |
| Molecular Weight | 463.346 |
| Exact Mass | 462.074799 |
| PSA | 22.82000 |
| LogP | 2.06350 |
| InChIKey | QFIVZQJPMLZRIS-UHFFFAOYSA-M |
| SMILES | [Br-].c1ccc(OCC[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| HS Code | 2931900090 |
|---|
|
~%
(2-Phenoxyethyl... CAS#:22409-83-2 |
| Literature: Crosby,J.; Stirling,C.J.M. Journal of the Chemical Society [Section] B: Physical Organic, 1970 , p. 671 - 679 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 2-Phenoxyethyltriphenylphosphonium-Ion |
| (2-Phenoxyethyl)(triphenyl)phosphonium bromide |
| Phosphonium, (2-phenoxyethyl)triphenyl-, bromide (1:1) |
| EINECS 244-963-7 |