4-Chloro-2-(1H-indol-3-ylmethyleneamino)benzoic acid
Modify Date: 2025-09-18 16:33:48
4-Chloro-2-(1H-indol-3-ylmethyleneamino)benzoic acid structure
|
Common Name | 4-Chloro-2-(1H-indol-3-ylmethyleneamino)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 22394-35-0 | Molecular Weight | 298.72400 | |
| Density | 1.37g/cm3 | Boiling Point | 511.2ºC at 760 mmHg | |
| Molecular Formula | C16H11ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 263ºC | |
| Name | 4-chloro-2-(indol-3-ylidenemethylamino)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.37g/cm3 |
|---|---|
| Boiling Point | 511.2ºC at 760 mmHg |
| Molecular Formula | C16H11ClN2O2 |
| Molecular Weight | 298.72400 |
| Flash Point | 263ºC |
| Exact Mass | 298.05100 |
| PSA | 61.69000 |
| LogP | 3.71570 |
| Vapour Pressure | 2.83E-11mmHg at 25°C |
| Index of Refraction | 1.666 |
| InChIKey | ANTCCAUGGSQGIR-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(Cl)cc1N=Cc1c[nH]c2ccccc12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-chloro-2-indol-3-ylmethyleneamino-benzoic acid |