2'-O-(2-Methoxyethyl)uridine structure
|
Common Name | 2'-O-(2-Methoxyethyl)uridine | ||
|---|---|---|---|---|
| CAS Number | 223777-15-9 | Molecular Weight | 302.280 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H18N2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 2'-O-(2-Methoxyethyl)uridine2'-O-(2-Methoxyethyl)-uridine is a synthetic oligonucleotide conversed from uridine. 2'-O-(2-Methoxyethyl)-uridine has the potential for chemotherapeutic agents development[1]. |
| Name | 1-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-(2-methoxyethoxy)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Description | 2'-O-(2-Methoxyethyl)-uridine is a synthetic oligonucleotide conversed from uridine. 2'-O-(2-Methoxyethyl)-uridine has the potential for chemotherapeutic agents development[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Molecular Formula | C12H18N2O7 |
| Molecular Weight | 302.280 |
| Exact Mass | 302.111389 |
| PSA | 123.01000 |
| LogP | -1.50 |
| Index of Refraction | 1.586 |
| InChIKey | XTXNROBDOKPICP-QCNRFFRDSA-N |
| SMILES | COCCOC1C(O)C(CO)OC1n1ccc(=O)[nH]c1=O |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2934999090 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2'-NITROBENZANILIDE |
| 2'-O-(2-Methoxyethyl)uridine |
| Uridine, 2'-O-(2-methoxyethyl)- |