Amine-PEG3-Desthiobiotin
Modify Date: 2025-11-14 11:31:02
Amine-PEG3-Desthiobiotin structure
|
Common Name | Amine-PEG3-Desthiobiotin | ||
|---|---|---|---|---|
| CAS Number | 2237234-71-6 | Molecular Weight | 388.50 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H36N4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Amine-PEG3-DesthiobiotinAmine-PEG3-Desthiobiotin is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Amine-PEG3-Desthiobiotin |
|---|
| Description | Amine-PEG3-Desthiobiotin is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C18H36N4O5 |
|---|---|
| Molecular Weight | 388.50 |
| InChIKey | RDKKYGNEWXGKMS-JKSUJKDBSA-N |
| SMILES | CC1NC(=O)NC1CCCCCC(=O)NCCOCCOCCOCCN |