CHEMBRDG-BB 4015415
Modify Date: 2025-08-25 18:15:14
CHEMBRDG-BB 4015415 structure
|
Common Name | CHEMBRDG-BB 4015415 | ||
|---|---|---|---|---|
| CAS Number | 22359-13-3 | Molecular Weight | 188.61200 | |
| Density | 1.284g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C7H9ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(2-chloroethyl)-6-methyl-1H-pyrimidine-2,4-dione |
|---|
| Density | 1.284g/cm3 |
|---|---|
| Molecular Formula | C7H9ClN2O2 |
| Molecular Weight | 188.61200 |
| Exact Mass | 188.03500 |
| PSA | 54.86000 |
| LogP | 0.08380 |
| Index of Refraction | 1.512 |
| InChIKey | IEGSUEHWIBYJIW-UHFFFAOYSA-N |
| SMILES | Cc1cc(=O)n(CCCl)c(=O)[nH]1 |
| RIDADR | NONH for all modes of transport |
|---|---|
| HS Code | 2933599090 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |