Benzyl (1R,5S,7s)-7-amino-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate structure
|
Common Name | Benzyl (1R,5S,7s)-7-amino-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2231663-74-2 | Molecular Weight | 276.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H20N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzyl (1R,5S,7s)-7-amino-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H20N2O3 |
|---|---|
| Molecular Weight | 276.33 |
| InChIKey | VDTSWQDXEFSEHS-AGUYFDCRSA-N |
| SMILES | NC1CC2COCC(C1)N2C(=O)OCc1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2231663-74-2? |
| A: Chinese name of 2231663-74-2 is 2231663-74-2. |
| Q: What is the English name of Benzyl (1R,5S,7s)-7-amino-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate? |
| A: The English name of Benzyl (1R,5S,7s)-7-amino-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate is Benzyl (1R,5S,7s)-7-amino-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate. |
| Q: What is the SMILES notation of Benzyl (1R,5S,7s)-7-amino-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate? |
| A: SMILES notation of Benzyl (1R,5S,7s)-7-amino-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate is NC1CC2COCC(C1)N2C(=O)OCc1ccccc1. |
| Q: What is the molecular formula of Benzyl (1R,5S,7s)-7-amino-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate? |
| A: Molecular formula of Benzyl (1R,5S,7s)-7-amino-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate is C15H20N2O3. |
| Q: What is the molecular weight of Benzyl (1R,5S,7s)-7-amino-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate? |
| A: Molecular weight of Benzyl (1R,5S,7s)-7-amino-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate is 276.33. |
| Q: What is the CAS number of Benzyl (1R,5S,7s)-7-amino-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate? |
| A: CAS number of Benzyl (1R,5S,7s)-7-amino-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate is 2231663-74-2. |
| Q: What is the InChIKey of Benzyl (1R,5S,7s)-7-amino-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate? |
| A: InChIKey of Benzyl (1R,5S,7s)-7-amino-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate is VDTSWQDXEFSEHS-AGUYFDCRSA-N. |