3-Cinnamyl-8-propionyl-3,8-diazabicyclo[3.2.1]octan-2-one structure
|
Common Name | 3-Cinnamyl-8-propionyl-3,8-diazabicyclo[3.2.1]octan-2-one | ||
|---|---|---|---|---|
| CAS Number | 22315-22-6 | Molecular Weight | 298.37900 | |
| Density | 1.166g/cm3 | Boiling Point | 546.4ºC at 760mmHg | |
| Molecular Formula | C18H22N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 259.2ºC | |
| Name | 3-(3-phenylprop-2-enyl)-8-propanoyl-3,8-diazabicyclo[3.2.1]octan-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.166g/cm3 |
|---|---|
| Boiling Point | 546.4ºC at 760mmHg |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.37900 |
| Flash Point | 259.2ºC |
| Exact Mass | 298.16800 |
| PSA | 40.62000 |
| LogP | 2.18740 |
| Vapour Pressure | 5.41E-12mmHg at 25°C |
| Index of Refraction | 1.595 |
| InChIKey | QHHNVIFYIZJACJ-UHFFFAOYSA-N |
| SMILES | CCC(=O)N1C2CCC1C(=O)N(CC=Cc1ccccc1)C2 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Cinnamyl-8-propionyl-3,8-diaza-bicyclo<3.2.1>octan-2-on |