Methyl (2S)-(2-chlorophenyl){[(4-nitrophenyl)sulfonyl]oxy}acetate
Modify Date: 2025-09-21 08:28:07
![Methyl (2S)-(2-chlorophenyl){[(4-nitrophenyl)sulfonyl]oxy}acetate Structure](https://image.chemsrc.com/caspic/315/223123-80-6.png)
Methyl (2S)-(2-chlorophenyl){[(4-nitrophenyl)sulfonyl]oxy}acetate structure
|
Common Name | Methyl (2S)-(2-chlorophenyl){[(4-nitrophenyl)sulfonyl]oxy}acetate | ||
|---|---|---|---|---|
| CAS Number | 223123-80-6 | Molecular Weight | 385.776 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 539.6±50.0 °C at 760 mmHg | |
| Molecular Formula | C15H12ClNO7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 280.1±30.1 °C | |
| Name | Methyl (2S)-(2-chlorophenyl){[(4-nitrophenyl)sulfonyl]oxy}acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 539.6±50.0 °C at 760 mmHg |
| Molecular Formula | C15H12ClNO7S |
| Molecular Weight | 385.776 |
| Flash Point | 280.1±30.1 °C |
| Exact Mass | 385.002289 |
| PSA | 123.87000 |
| LogP | 3.72 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.599 |
| InChIKey | BPBBJZNRUKPSDJ-AWEZNQCLSA-N |
| SMILES | COC(=O)C(OS(=O)(=O)c1ccc([N+](=O)[O-])cc1)c1ccccc1Cl |
| HS Code | 2916399090 |
|---|
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Methyl (2S)-(2-chlorophenyl){[(4-nitrophenyl)sulfonyl]oxy}acetate |
| Benzeneacetic acid, 2-chloro-α-[[(4-nitrophenyl)sulfonyl]oxy]-, methyl ester, (αS)- |