benzoic acid,2-ethenylbenzene-1,4-diol
Modify Date: 2024-01-09 06:32:24
benzoic acid,2-ethenylbenzene-1,4-diol structure
|
Common Name | benzoic acid,2-ethenylbenzene-1,4-diol | ||
|---|---|---|---|---|
| CAS Number | 2231-94-9 | Molecular Weight | 380.39100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H20O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | benzoic acid,2-ethenylbenzene-1,4-diol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H20O6 |
|---|---|
| Molecular Weight | 380.39100 |
| Exact Mass | 380.12600 |
| PSA | 115.06000 |
| LogP | 4.51040 |
| InChIKey | PYRPPMDFFULBDH-UHFFFAOYSA-N |
| SMILES | C=Cc1cc(O)ccc1O.O=C(O)c1ccccc1.O=C(O)c1ccccc1 |
| HS Code | 2916399090 |
|---|
|
~%
benzoic acid,2-... CAS#:2231-94-9 |
| Literature: Ezrin et al. Journal of the American Chemical Society, 1953 , vol. 75, p. 1610,1611 |
|
~%
benzoic acid,2-... CAS#:2231-94-9 |
| Literature: Zhou, Qi-Feng; Wan, Xinhua; Zhu, Xin-Long; Zhang, Fei; Feng, Xinde Molecular Crystals and Liquid Crystals Science and Technology, Section A: Molecular Crystals and Liquid Crystals, 1993 , vol. 231, p. 107 - 118 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2,5-bis-benzoyloxy-styrene |
| 2,5-Dibenzoyloxy-vinyl-benzol |
| 1,4-Benzenediol,2-ethenyl-,dibenzoate |
| 2,5-Bis-benzoyloxy-styrol |