4,4-Difluoro-1-{2-[methyl(propan-2-yl)amino]ethyl}cyclohexan-1-amine
Modify Date: 2025-09-14 10:50:02
![4,4-Difluoro-1-{2-[methyl(propan-2-yl)amino]ethyl}cyclohexan-1-amine Structure](https://www.chemsrc.com/extcaspic/285/2228811-47-8.png)
4,4-Difluoro-1-{2-[methyl(propan-2-yl)amino]ethyl}cyclohexan-1-amine structure
|
Common Name | 4,4-Difluoro-1-{2-[methyl(propan-2-yl)amino]ethyl}cyclohexan-1-amine | ||
|---|---|---|---|---|
| CAS Number | 2228811-47-8 | Molecular Weight | 234.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H24F2N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4,4-Difluoro-1-{2-[methyl(propan-2-yl)amino]ethyl}cyclohexan-1-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H24F2N2 |
|---|---|
| Molecular Weight | 234.33 |
| InChIKey | GEOZPFPTLAIVCQ-UHFFFAOYSA-N |
| SMILES | CC(C)N(C)CCC1(N)CCC(F)(F)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 4,4-Difluoro-1-{2-[methyl(propan-2-yl)amino]ethyl}cyclohexan-1-amine? |
| A: The English name of 4,4-Difluoro-1-{2-[methyl(propan-2-yl)amino]ethyl}cyclohexan-1-amine is 4,4-Difluoro-1-{2-[methyl(propan-2-yl)amino]ethyl}cyclohexan-1-amine. |
| Q: What is the InChIKey of 4,4-Difluoro-1-{2-[methyl(propan-2-yl)amino]ethyl}cyclohexan-1-amine? |
| A: InChIKey of 4,4-Difluoro-1-{2-[methyl(propan-2-yl)amino]ethyl}cyclohexan-1-amine is GEOZPFPTLAIVCQ-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 4,4-Difluoro-1-{2-[methyl(propan-2-yl)amino]ethyl}cyclohexan-1-amine? |
| A: SMILES notation of 4,4-Difluoro-1-{2-[methyl(propan-2-yl)amino]ethyl}cyclohexan-1-amine is CC(C)N(C)CCC1(N)CCC(F)(F)CC1. |
| Q: What is the CAS number of 4,4-Difluoro-1-{2-[methyl(propan-2-yl)amino]ethyl}cyclohexan-1-amine? |
| A: CAS number of 4,4-Difluoro-1-{2-[methyl(propan-2-yl)amino]ethyl}cyclohexan-1-amine is 2228811-47-8. |
| Q: What is the molecular formula of 4,4-Difluoro-1-{2-[methyl(propan-2-yl)amino]ethyl}cyclohexan-1-amine? |
| A: Molecular formula of 4,4-Difluoro-1-{2-[methyl(propan-2-yl)amino]ethyl}cyclohexan-1-amine is C12H24F2N2. |
| Q: What is the Chinese name of 2228811-47-8? |
| A: Chinese name of 2228811-47-8 is 2228811-47-8. |
| Q: What is the molecular weight of 4,4-Difluoro-1-{2-[methyl(propan-2-yl)amino]ethyl}cyclohexan-1-amine? |
| A: Molecular weight of 4,4-Difluoro-1-{2-[methyl(propan-2-yl)amino]ethyl}cyclohexan-1-amine is 234.33. |