O-[2,2-dimethyl-3-(2,4,5-trifluorophenyl)propyl]hydroxylamine
Modify Date: 2025-10-11 10:28:22
![O-[2,2-dimethyl-3-(2,4,5-trifluorophenyl)propyl]hydroxylamine Structure](https://www.chemsrc.com/extcaspic/239/2228675-80-5.png)
O-[2,2-dimethyl-3-(2,4,5-trifluorophenyl)propyl]hydroxylamine structure
|
Common Name | O-[2,2-dimethyl-3-(2,4,5-trifluorophenyl)propyl]hydroxylamine | ||
|---|---|---|---|---|
| CAS Number | 2228675-80-5 | Molecular Weight | 233.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H14F3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | O-[2,2-dimethyl-3-(2,4,5-trifluorophenyl)propyl]hydroxylamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H14F3NO |
|---|---|
| Molecular Weight | 233.23 |
| InChIKey | QYIVAKKQHKIBNN-UHFFFAOYSA-N |
| SMILES | CC(C)(CON)Cc1cc(F)c(F)cc1F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of O-[2,2-dimethyl-3-(2,4,5-trifluorophenyl)propyl]hydroxylamine? |
| A: The English name of O-[2,2-dimethyl-3-(2,4,5-trifluorophenyl)propyl]hydroxylamine is O-[2,2-dimethyl-3-(2,4,5-trifluorophenyl)propyl]hydroxylamine. |
| Q: What is the Chinese name of 2228675-80-5? |
| A: Chinese name of 2228675-80-5 is 2228675-80-5. |
| Q: What is the CAS number of O-[2,2-dimethyl-3-(2,4,5-trifluorophenyl)propyl]hydroxylamine? |
| A: CAS number of O-[2,2-dimethyl-3-(2,4,5-trifluorophenyl)propyl]hydroxylamine is 2228675-80-5. |
| Q: What is the SMILES notation of O-[2,2-dimethyl-3-(2,4,5-trifluorophenyl)propyl]hydroxylamine? |
| A: SMILES notation of O-[2,2-dimethyl-3-(2,4,5-trifluorophenyl)propyl]hydroxylamine is CC(C)(CON)Cc1cc(F)c(F)cc1F. |
| Q: What is the InChIKey of O-[2,2-dimethyl-3-(2,4,5-trifluorophenyl)propyl]hydroxylamine? |
| A: InChIKey of O-[2,2-dimethyl-3-(2,4,5-trifluorophenyl)propyl]hydroxylamine is QYIVAKKQHKIBNN-UHFFFAOYSA-N. |
| Q: What is the molecular weight of O-[2,2-dimethyl-3-(2,4,5-trifluorophenyl)propyl]hydroxylamine? |
| A: Molecular weight of O-[2,2-dimethyl-3-(2,4,5-trifluorophenyl)propyl]hydroxylamine is 233.23. |
| Q: What is the molecular formula of O-[2,2-dimethyl-3-(2,4,5-trifluorophenyl)propyl]hydroxylamine? |
| A: Molecular formula of O-[2,2-dimethyl-3-(2,4,5-trifluorophenyl)propyl]hydroxylamine is C11H14F3NO. |