2-{3-[(Dimethylamino)methyl]phenyl}butanoic acid
Modify Date: 2026-08-06 17:45:10
![2-{3-[(Dimethylamino)methyl]phenyl}butanoic acid Structure](https://www.chemsrc.com/extcaspic/412/2228362-26-1.png)
2-{3-[(Dimethylamino)methyl]phenyl}butanoic acid structure
|
Common Name | 2-{3-[(Dimethylamino)methyl]phenyl}butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 2228362-26-1 | Molecular Weight | 221.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-{3-[(Dimethylamino)methyl]phenyl}butanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H19NO2 |
|---|---|
| Molecular Weight | 221.29 |
| InChIKey | SAQHCXICAUGDAD-UHFFFAOYSA-N |
| SMILES | CCC(C(=O)O)c1cccc(CN(C)C)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-{3-[(Dimethylamino)methyl]phenyl}butanoic acid? |
| A: InChIKey of 2-{3-[(Dimethylamino)methyl]phenyl}butanoic acid is SAQHCXICAUGDAD-UHFFFAOYSA-N. |
| Q: What is the English name of 2-{3-[(Dimethylamino)methyl]phenyl}butanoic acid? |
| A: The English name of 2-{3-[(Dimethylamino)methyl]phenyl}butanoic acid is 2-{3-[(Dimethylamino)methyl]phenyl}butanoic acid. |
| Q: What is the molecular weight of 2-{3-[(Dimethylamino)methyl]phenyl}butanoic acid? |
| A: Molecular weight of 2-{3-[(Dimethylamino)methyl]phenyl}butanoic acid is 221.29. |
| Q: What is the CAS number of 2-{3-[(Dimethylamino)methyl]phenyl}butanoic acid? |
| A: CAS number of 2-{3-[(Dimethylamino)methyl]phenyl}butanoic acid is 2228362-26-1. |
| Q: What is the molecular formula of 2-{3-[(Dimethylamino)methyl]phenyl}butanoic acid? |
| A: Molecular formula of 2-{3-[(Dimethylamino)methyl]phenyl}butanoic acid is C13H19NO2. |
| Q: What is the SMILES notation of 2-{3-[(Dimethylamino)methyl]phenyl}butanoic acid? |
| A: SMILES notation of 2-{3-[(Dimethylamino)methyl]phenyl}butanoic acid is CCC(C(=O)O)c1cccc(CN(C)C)c1. |
| Q: What is the Chinese name of 2228362-26-1? |
| A: Chinese name of 2228362-26-1 is 2228362-26-1. |