6-chloro-8-(prop-2-yn-1-yl)-3,4-dihydro-2H-1,5-benzodioxepine
Modify Date: 2026-08-05 19:06:57
6-chloro-8-(prop-2-yn-1-yl)-3,4-dihydro-2H-1,5-benzodioxepine structure
|
Common Name | 6-chloro-8-(prop-2-yn-1-yl)-3,4-dihydro-2H-1,5-benzodioxepine | ||
|---|---|---|---|---|
| CAS Number | 2228309-95-1 | Molecular Weight | 222.67 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H11ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-chloro-8-(prop-2-yn-1-yl)-3,4-dihydro-2H-1,5-benzodioxepine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H11ClO2 |
|---|---|
| Molecular Weight | 222.67 |
| InChIKey | HZZFMDWSFVMGFE-UHFFFAOYSA-N |
| SMILES | C#CCc1cc(Cl)c2c(c1)OCCCO2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 6-chloro-8-(prop-2-yn-1-yl)-3,4-dihydro-2H-1,5-benzodioxepine? |
| A: SMILES notation of 6-chloro-8-(prop-2-yn-1-yl)-3,4-dihydro-2H-1,5-benzodioxepine is C#CCc1cc(Cl)c2c(c1)OCCCO2. |
| Q: What is the CAS number of 6-chloro-8-(prop-2-yn-1-yl)-3,4-dihydro-2H-1,5-benzodioxepine? |
| A: CAS number of 6-chloro-8-(prop-2-yn-1-yl)-3,4-dihydro-2H-1,5-benzodioxepine is 2228309-95-1. |
| Q: What is the Chinese name of 2228309-95-1? |
| A: Chinese name of 2228309-95-1 is 2228309-95-1. |
| Q: What is the molecular weight of 6-chloro-8-(prop-2-yn-1-yl)-3,4-dihydro-2H-1,5-benzodioxepine? |
| A: Molecular weight of 6-chloro-8-(prop-2-yn-1-yl)-3,4-dihydro-2H-1,5-benzodioxepine is 222.67. |
| Q: What is the English name of 6-chloro-8-(prop-2-yn-1-yl)-3,4-dihydro-2H-1,5-benzodioxepine? |
| A: The English name of 6-chloro-8-(prop-2-yn-1-yl)-3,4-dihydro-2H-1,5-benzodioxepine is 6-chloro-8-(prop-2-yn-1-yl)-3,4-dihydro-2H-1,5-benzodioxepine. |
| Q: What is the molecular formula of 6-chloro-8-(prop-2-yn-1-yl)-3,4-dihydro-2H-1,5-benzodioxepine? |
| A: Molecular formula of 6-chloro-8-(prop-2-yn-1-yl)-3,4-dihydro-2H-1,5-benzodioxepine is C12H11ClO2. |
| Q: What is the InChIKey of 6-chloro-8-(prop-2-yn-1-yl)-3,4-dihydro-2H-1,5-benzodioxepine? |
| A: InChIKey of 6-chloro-8-(prop-2-yn-1-yl)-3,4-dihydro-2H-1,5-benzodioxepine is HZZFMDWSFVMGFE-UHFFFAOYSA-N. |