2-Methoxy-3,3,4,4-tetramethylhexanoic acid
Modify Date: 2026-07-25 17:00:52
2-Methoxy-3,3,4,4-tetramethylhexanoic acid structure
|
Common Name | 2-Methoxy-3,3,4,4-tetramethylhexanoic acid | ||
|---|---|---|---|---|
| CAS Number | 2228296-71-5 | Molecular Weight | 202.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H22O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Methoxy-3,3,4,4-tetramethylhexanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H22O3 |
|---|---|
| Molecular Weight | 202.29 |
| InChIKey | SLFQYNGWYWATEI-UHFFFAOYSA-N |
| SMILES | CCC(C)(C)C(C)(C)C(OC)C(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-Methoxy-3,3,4,4-tetramethylhexanoic acid? |
| A: Molecular formula of 2-Methoxy-3,3,4,4-tetramethylhexanoic acid is C11H22O3. |
| Q: What is the SMILES notation of 2-Methoxy-3,3,4,4-tetramethylhexanoic acid? |
| A: SMILES notation of 2-Methoxy-3,3,4,4-tetramethylhexanoic acid is CCC(C)(C)C(C)(C)C(OC)C(=O)O. |
| Q: What is the molecular weight of 2-Methoxy-3,3,4,4-tetramethylhexanoic acid? |
| A: Molecular weight of 2-Methoxy-3,3,4,4-tetramethylhexanoic acid is 202.29. |
| Q: What is the Chinese name of 2228296-71-5? |
| A: Chinese name of 2228296-71-5 is 2228296-71-5. |
| Q: What is the CAS number of 2-Methoxy-3,3,4,4-tetramethylhexanoic acid? |
| A: CAS number of 2-Methoxy-3,3,4,4-tetramethylhexanoic acid is 2228296-71-5. |
| Q: What is the English name of 2-Methoxy-3,3,4,4-tetramethylhexanoic acid? |
| A: The English name of 2-Methoxy-3,3,4,4-tetramethylhexanoic acid is 2-Methoxy-3,3,4,4-tetramethylhexanoic acid. |
| Q: What is the InChIKey of 2-Methoxy-3,3,4,4-tetramethylhexanoic acid? |
| A: InChIKey of 2-Methoxy-3,3,4,4-tetramethylhexanoic acid is SLFQYNGWYWATEI-UHFFFAOYSA-N. |