4-amino-6-phenyl-3-sulfanylidene-2H-1,2,4-triazin-5-one structure
|
Common Name | 4-amino-6-phenyl-3-sulfanylidene-2H-1,2,4-triazin-5-one | ||
|---|---|---|---|---|
| CAS Number | 22278-82-6 | Molecular Weight | 220.25100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H8N4OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-amino-6-phenyl-3-sulfanylidene-2H-1,2,4-triazin-5-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H8N4OS |
|---|---|
| Molecular Weight | 220.25100 |
| Exact Mass | 220.04200 |
| PSA | 112.60000 |
| LogP | 0.88900 |
| InChIKey | URPPDVOLORWAAP-UHFFFAOYSA-N |
| SMILES | Nn1c(=S)[nH]nc(-c2ccccc2)c1=O |
|
~53%
4-amino-6-pheny... CAS#:22278-82-6 |
| Literature: Mironovich; Salistaya; Promonenkov Russian Journal of General Chemistry, 2001 , vol. 71, # 6 p. 991 - 992 |
|
~%
4-amino-6-pheny... CAS#:22278-82-6 |
| Literature: Mironovich; Salistaya; Promonenkov Russian Journal of General Chemistry, 2001 , vol. 71, # 6 p. 991 - 992 |
| 4-amino-3-thioxo-6-phenyl-2,3-dihydro-[1,2,4]triazin-5(4H)-one |
| 4-amino-6-phenyl-3-sulfanyl-1,2,4-triazin-5(4H)-one |
| 4-amino-6-phenyl-5-oxo-3-thioxo-2,3,4,5-tetrahydro<1,2,4>triazine |
| 4-amino-6-phenyl-1,2,4-triazine-3(2H)-thion-5(4H)-one |
| 4-Amino-6-phenyl-3-thioxo-2,3,4,5-tetrahydro-1,2,4-triazin-5-one |
| BB_SC-6096 |
| 4-amino-6-phenyl-3-thioxo-3,4-dihydro-2H-[1,2,4]triazin-5-one |
| 4-amino-6-phenyl-3-thioxo-3,4-dihydro-1,2,4-triazin-5(2H)-one |
| 4-Amino-5-oxo-3-thioxo-6-phenyl-2,3,4,5-tetrahydro-1,2,4-triazin |