ADH-6 structure
|
Common Name | ADH-6 | ||
|---|---|---|---|---|
| CAS Number | 2227429-65-2 | Molecular Weight | 640.64 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C29H36N8O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of ADH-6ADH-6 is a tripyridylamide compound. ADH-6 abrogates self-assembly of the aggregation-nucleating subdomain of mutant p53 DBD. ADH-6 targets and dissociates mutant p53 aggregates in human cancer cells, which restores p53's transcriptional activity, leading to cell cycle arrest and apoptosis. ADH-6 has the potential for the research of cancer diseases[1]. |
| Name | ADH-6 |
|---|
| Description | ADH-6 is a tripyridylamide compound. ADH-6 abrogates self-assembly of the aggregation-nucleating subdomain of mutant p53 DBD. ADH-6 targets and dissociates mutant p53 aggregates in human cancer cells, which restores p53's transcriptional activity, leading to cell cycle arrest and apoptosis. ADH-6 has the potential for the research of cancer diseases[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C29H36N8O9 |
|---|---|
| Molecular Weight | 640.64 |
| InChIKey | KDVRSKDEDDWURT-UHFFFAOYSA-N |
| SMILES | CCCCOc1nc(C(=O)Nc2ccc(C(=O)Nc3ccc(C(=O)OC)nc3OCCCN)nc2OCCCN)ccc1[N+](=O)[O-] |