6-Nitro-1-tetralone
Modify Date: 2025-08-27 16:52:54
6-Nitro-1-tetralone structure
|
Common Name | 6-Nitro-1-tetralone | ||
|---|---|---|---|---|
| CAS Number | 22246-26-0 | Molecular Weight | 191.18300 | |
| Density | 1.322g/cm3 | Boiling Point | 361.205ºC at 760 mmHg | |
| Molecular Formula | C10H9NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183.71ºC | |
| Name | 6-nitro-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.322g/cm3 |
|---|---|
| Boiling Point | 361.205ºC at 760 mmHg |
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.18300 |
| Flash Point | 183.71ºC |
| Exact Mass | 191.05800 |
| PSA | 62.89000 |
| LogP | 2.63700 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.604 |
| InChIKey | RKSKZEHRRQUBEJ-UHFFFAOYSA-N |
| SMILES | O=C1CCCc2cc([N+](=O)[O-])ccc21 |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 6-Nitro-tetralon-(1) |
| 6-nitro-3,4-dihydro-1(2H)-naphthalenone |
| 6-Nitro-3,4-dihydro-2H-naphthalin-1-on |
| 3,4-dihydro-6-nitronaphthalen-1(2H)-one |
| 6-nitro-1-tetralone |