MethylCBI-azaindole-benzamide-MOM-Boc-ethylenediamine-D
Modify Date: 2025-08-26 16:16:49
MethylCBI-azaindole-benzamide-MOM-Boc-ethylenediamine-D structure
|
Common Name | MethylCBI-azaindole-benzamide-MOM-Boc-ethylenediamine-D | ||
|---|---|---|---|---|
| CAS Number | 2222445-87-4 | Molecular Weight | 859.36 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C44H51ClN6O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of MethylCBI-azaindole-benzamide-MOM-Boc-ethylenediamine-DMethylCBI-azaindole-benzamide-MOM-Boc-ethylenediamine-D is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Name | MethylCBI-azaindole-benzamide-MOM-Boc-ethylenediamine-D |
|---|
| Description | MethylCBI-azaindole-benzamide-MOM-Boc-ethylenediamine-D is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| Target |
Cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker[1]. |
| References |
| Molecular Formula | C44H51ClN6O10 |
|---|---|
| Molecular Weight | 859.36 |
| InChIKey | VQQZUHVNVDPTLO-SSEXGKCCSA-N |
| SMILES | COCOc1ccc(C(=O)Nc2ccc3nc(C(=O)N4CC(CCl)c5c4cc(OC(=O)N(CCOCCO)CCN(C)C(=O)OC(C)(C)C)c4cccc(C)c54)cn3c2)cc1 |