Sulfone, 1-ethyl-2-iodo-1-butenyl p-tolyl,(E)- (8CI)
Modify Date: 2025-09-23 20:43:08
Sulfone, 1-ethyl-2-iodo-1-butenyl p-tolyl,(E)- (8CI) structure
|
Common Name | Sulfone, 1-ethyl-2-iodo-1-butenyl p-tolyl,(E)- (8CI) | ||
|---|---|---|---|---|
| CAS Number | 22214-92-2 | Molecular Weight | 364.24200 | |
| Density | 1.504g/cm3 | Boiling Point | 428.7ºC at 760 mmHg | |
| Molecular Formula | C13H17IO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.1ºC | |
| Name | 1-[(E)-4-iodohex-3-en-3-yl]sulfonyl-4-methylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.504g/cm3 |
|---|---|
| Boiling Point | 428.7ºC at 760 mmHg |
| Molecular Formula | C13H17IO2S |
| Molecular Weight | 364.24200 |
| Flash Point | 213.1ºC |
| Exact Mass | 363.99900 |
| PSA | 42.52000 |
| LogP | 5.31610 |
| Vapour Pressure | 3.71E-07mmHg at 25°C |
| Index of Refraction | 1.578 |
| InChIKey | RKXHXTZXHRZLGX-OUKQBFOZSA-N |
| SMILES | CCC(I)=C(CC)S(=O)(=O)c1ccc(C)cc1 |
|
~%
Sulfone, 1-ethy... CAS#:22214-92-2 |
| Literature: Truce,W.E.; Wolf,G.C. Journal of Organic Chemistry, 1971 , vol. 36, # 13 p. 1727 - 1732 |
|
~%
Sulfone, 1-ethy... CAS#:22214-92-2 |
| Literature: Truce,W.E.; Wolf,G.C. Journal of the Chemical Society [Section] D: Chemical Communications, 1969 , p. 150 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| (E)-3-iodo-4-(p-tolylsulphonyl)hex-3-ene |