Linrodostat mesylate
Linrodostat mesylate structure
|
Common Name | Linrodostat mesylate | ||
|---|---|---|---|---|
| CAS Number | 2221034-29-1 | Molecular Weight | 507.02 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H28ClFN2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Linrodostat mesylateLinrodostat (BMS-986205, ONO-7701, and F001287) is a selective and orally active IDO1 inhibitor with potential immunomodulating and antineoplastic activities. By inhibiting IDO1 and reducing kynurenine in tumor cells, BMS-986205 restores and promotes the proliferation and activation of various immune cells and causes a reduction in tumor-associated regulatory T cells (Tregs). |
| Name | Linrodostat mesylate |
|---|
| Description | Linrodostat (BMS-986205, ONO-7701, and F001287) is a selective and orally active IDO1 inhibitor with potential immunomodulating and antineoplastic activities. By inhibiting IDO1 and reducing kynurenine in tumor cells, BMS-986205 restores and promotes the proliferation and activation of various immune cells and causes a reduction in tumor-associated regulatory T cells (Tregs). |
|---|
| Molecular Formula | C25H28ClFN2O4S |
|---|---|
| Molecular Weight | 507.02 |
| InChIKey | LZNFBNWGSDOVIO-WNDXPBGESA-N |
| SMILES | CC(C(=O)Nc1ccc(Cl)cc1)C1CCC(c2ccnc3ccc(F)cc23)CC1.CS(=O)(=O)O |