2,2'-(6-methyl-2-propylpyrimidin-4-yl)iminodiethanol structure
|
Common Name | 2,2'-(6-methyl-2-propylpyrimidin-4-yl)iminodiethanol | ||
|---|---|---|---|---|
| CAS Number | 22177-56-6 | Molecular Weight | 239.31400 | |
| Density | 1.153g/cm3 | Boiling Point | 421.7ºC at 760mmHg | |
| Molecular Formula | C12H21N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.8ºC | |
| Name | 2-[2-hydroxyethyl-(6-methyl-2-propylpyrimidin-4-yl)amino]ethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.153g/cm3 |
|---|---|
| Boiling Point | 421.7ºC at 760mmHg |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.31400 |
| Flash Point | 208.8ºC |
| Exact Mass | 239.16300 |
| PSA | 69.48000 |
| LogP | 0.52850 |
| Vapour Pressure | 7.27E-08mmHg at 25°C |
| Index of Refraction | 1.57 |
| InChIKey | CQDORQXCAOMVBU-UHFFFAOYSA-N |
| SMILES | CCCc1nc(C)cc(N(CCO)CCO)n1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| einecs 244-818-8 |