3,3-bis(ethylsulfonyl)pentane structure
|
Common Name | 3,3-bis(ethylsulfonyl)pentane | ||
|---|---|---|---|---|
| CAS Number | 2217-59-6 | Molecular Weight | 256.38300 | |
| Density | 1.169g/cm3 | Boiling Point | 452.4ºC at 760 mmHg | |
| Molecular Formula | C9H20O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 284.7ºC | |
| Name | 3,3-bis(ethylsulfonyl)pentane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.169g/cm3 |
|---|---|
| Boiling Point | 452.4ºC at 760 mmHg |
| Molecular Formula | C9H20O4S2 |
| Molecular Weight | 256.38300 |
| Flash Point | 284.7ºC |
| Exact Mass | 256.08000 |
| PSA | 85.04000 |
| LogP | 3.53370 |
| Vapour Pressure | 6.01E-08mmHg at 25°C |
| Index of Refraction | 1.471 |
| InChIKey | VTZYVPLHCQBWSP-UHFFFAOYSA-N |
| SMILES | CCC(CC)(S(=O)(=O)CC)S(=O)(=O)CC |
| HS Code | 2904100000 |
|---|
| HS Code | 2904100000 |
|---|---|
| Summary | 2904100000 derivatives containing only sulpho groups, their salts and ethyl esters。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| Sulfonyldiethylmethane |
| Tetronal |
| 3,3-Bis-aethansulfonyl-pentan |
| 3,3-bis-ethanesulfonyl-pentane |