2-(4-aminophenyl)-2-phenylpropanenitrile structure
|
Common Name | 2-(4-aminophenyl)-2-phenylpropanenitrile | ||
|---|---|---|---|---|
| CAS Number | 22156-68-9 | Molecular Weight | 222.28500 | |
| Density | 1.12g/cm3 | Boiling Point | 389.9ºC at 760mmHg | |
| Molecular Formula | C15H14N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.6ºC | |
| Name | 2-(4-aminophenyl)-2-phenylpropanenitrile |
|---|
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 389.9ºC at 760mmHg |
| Molecular Formula | C15H14N2 |
| Molecular Weight | 222.28500 |
| Flash Point | 189.6ºC |
| Exact Mass | 222.11600 |
| PSA | 49.81000 |
| LogP | 3.67958 |
| Vapour Pressure | 2.75E-06mmHg at 25°C |
| Index of Refraction | 1.607 |
| InChIKey | FXDPMMRRRJRSLY-UHFFFAOYSA-N |
| SMILES | CC(C#N)(c1ccccc1)c1ccc(N)cc1 |
|
~%
2-(4-aminopheny... CAS#:22156-68-9 |
| Literature: Zuccarello,W.A. et al. Journal of Medicinal Chemistry, 1969 , vol. 12, # 1 p. 9 - 15 |
|
~%
2-(4-aminopheny... CAS#:22156-68-9 |
| Literature: Makosza,M. et al. Tetrahedron, 1974 , vol. 30, p. 3723 - 3735 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |