4-nitrophenyl-beta-l-fucopyranoside
Modify Date: 2025-08-25 08:12:23
4-nitrophenyl-beta-l-fucopyranoside structure
|
Common Name | 4-nitrophenyl-beta-l-fucopyranoside | ||
|---|---|---|---|---|
| CAS Number | 22153-71-5 | Molecular Weight | 285.25000 | |
| Density | 1.503 g/cm3 | Boiling Point | 515.4ºC at 760 mmHg | |
| Molecular Formula | C12H15NO7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 265.5ºC | |
| Name | 4-NITROPHENYL-β-L-FUCOPYRANOSIDE |
|---|---|
| Synonym | More Synonyms |
| Density | 1.503 g/cm3 |
|---|---|
| Boiling Point | 515.4ºC at 760 mmHg |
| Molecular Formula | C12H15NO7 |
| Molecular Weight | 285.25000 |
| Flash Point | 265.5ºC |
| Exact Mass | 285.08500 |
| PSA | 124.97000 |
| LogP | 0.32430 |
| Vapour Pressure | 1.9E-11mmHg at 25°C |
| Index of Refraction | 1.623 |
| InChIKey | YILIDCGSXCGACV-NFOQIUCISA-N |
| SMILES | CC1OC(Oc2ccc([N+](=O)[O-])cc2)C(O)C(O)C1O |
| Storage condition | −20°C |
| WGK Germany | 3 |
|---|---|
| HS Code | 2932999099 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:69936-58-9| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Nitrophenylrhamnoside |
| 3-Nitrophenyl a-L-rhamnopyranoside |
| 4-Nitrophenyl b-L-fucopyranoside |
| 4-Nitrophenyl 6-Deoxy-beta-L-Galactopyranoside |
| MFCD00063699 |
| EINECS 244-808-3 |