Boc-(2S,5R)-5-phenylpyrrolidine-2-carboxylic acid structure
|
Common Name | Boc-(2S,5R)-5-phenylpyrrolidine-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 221352-49-4 | Molecular Weight | 291.34200 | |
| Density | 1.196 g/cm3 | Boiling Point | 441.5ºC at 760 mmHg | |
| Molecular Formula | C16H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2S,5R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-5-phenylpyrrolidine-2-carboxylic acid |
|---|
| Density | 1.196 g/cm3 |
|---|---|
| Boiling Point | 441.5ºC at 760 mmHg |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.34200 |
| Exact Mass | 291.14700 |
| PSA | 66.84000 |
| LogP | 3.14970 |
| Vapour Pressure | 1.43E-08mmHg at 25°C |
| Index of Refraction | 1.548 |
| InChIKey | ADTXMICUZGOWDF-OLZOCXBDSA-N |
| SMILES | CC(C)(C)OC(=O)N1C(C(=O)O)CCC1c1ccccc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |